CymitQuimica logo

CAS 19259-90-6

:

Acetyl-d3 chloride

Description:
Acetyl-d3 chloride, with the CAS number 19259-90-6, is a deuterated derivative of acetyl chloride, where the hydrogen atoms in the acetyl group are replaced by deuterium isotopes. This compound is characterized by its molecular formula, which reflects the presence of deuterium, contributing to its unique isotopic properties. Acetyl-d3 chloride is typically a colorless liquid with a pungent odor, similar to that of standard acetyl chloride. It is highly reactive, particularly with water, leading to the formation of acetic acid and hydrochloric acid upon hydrolysis. This reactivity makes it useful in organic synthesis, particularly in the preparation of deuterated compounds for use in NMR spectroscopy and other analytical techniques. Due to its reactivity and potential hazards, including corrosiveness and toxicity, it must be handled with appropriate safety precautions in a controlled laboratory environment. Its applications extend to research in various fields, including medicinal chemistry and materials science, where isotopic labeling can provide insights into molecular behavior and interactions.
Formula:C2D3ClO
InChI:InChI=1/C2H3ClO/c1-2(3)4/h1H3/i1D3
InChI key:InChIKey=WETWJCDKMRHUPV-FIBGUPNXSA-N
SMILES:C(C(=O)Cl)([2H])([2H])[2H]
Synonyms:
  • (2H3)Acetyl chloride
  • (~2~H_3_)acetyl chloride
  • Acetyl chloride-d<sub>3</sub>
  • Acetyl-d<sub>3</sub> chloride
  • Trideuteroacetyl chloride
Found 4 products.