CymitQuimica logo

CAS 192702-05-9

:

1H-Pyrazole-3-carboxylicacid, 5-(4-chloro-3-methylphenyl)-, methyl ester

Description:
1H-Pyrazole-3-carboxylic acid, 5-(4-chloro-3-methylphenyl)-, methyl ester, identified by CAS number 192702-05-9, is a chemical compound characterized by its pyrazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group at the 3-position and a methyl ester group, indicating it can undergo hydrolysis to release methanol and form the corresponding acid. The presence of a 4-chloro-3-methylphenyl substituent at the 5-position contributes to its potential biological activity and lipophilicity. The compound is likely to exhibit moderate solubility in organic solvents due to its ester functionality, while its acidic nature may influence its reactivity and interactions in various chemical environments. Such compounds are often of interest in medicinal chemistry and agrochemical applications, where they may serve as intermediates or active pharmaceutical ingredients. Overall, the unique structural features of this compound suggest potential utility in various chemical and biological contexts.
Formula:C12H11ClN2O2
InChI:InChI=1S/C12H11ClN2O2/c1-7-5-8(3-4-9(7)13)10-6-11(15-14-10)12(16)17-2/h3-6H,1-2H3,(H,14,15)
InChI key:InChIKey=AWYAGOWXRPDDJE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(NN1)C2=CC(C)=C(Cl)C=C2
Found 3 products.