CymitQuimica logo

CAS 19278-82-1

:

5-Hydroxy-3(2H)-benzofuranone

Description:
5-Hydroxy-3(2H)-benzofuranone, also known as coumarin-3-carboxylic acid, is an organic compound characterized by its fused benzofuran structure, which contributes to its aromatic properties. This compound typically appears as a white to pale yellow crystalline solid and is soluble in organic solvents like ethanol and acetone, but has limited solubility in water. It exhibits a range of biological activities, including potential antioxidant and anti-inflammatory properties, making it of interest in pharmaceutical and cosmetic applications. The presence of the hydroxyl group enhances its reactivity and ability to form hydrogen bonds, influencing its interactions in biological systems. Additionally, 5-Hydroxy-3(2H)-benzofuranone can undergo various chemical reactions, such as esterification and oxidation, which can be exploited in synthetic organic chemistry. Its CAS number, 19278-82-1, serves as a unique identifier for regulatory and safety information. Overall, this compound is notable for its structural features and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C8H6O3
InChI:InChI=1S/C8H6O3/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-3,9H,4H2
InChI key:InChIKey=WCHUTMOUMWZQFD-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(O)C2)OC1
Synonyms:
  • 5-Hydroxy-3-coumaranone
  • 5-Hydroxy-3(2H)-benzofuranone
  • 3(2H)-Benzofuranone, 5-hydroxy-
  • 5-Hydroxybenzofuran-3(2H)-one
Found 3 products.