CAS 192883-12-8
:Decanamide, 3-hydroxy-N-[(3S)-tetrahydro-2-oxo-3-furanyl]-
Description:
Decanamide, 3-hydroxy-N-[(3S)-tetrahydro-2-oxo-3-furanyl]- is a chemical compound characterized by its amide functional group, which is derived from decanoic acid. This substance features a long hydrophobic decyl chain, contributing to its lipophilicity, while the presence of a hydroxyl group and a tetrahydrofuran moiety introduces polar characteristics, enhancing its solubility in polar solvents. The stereochemistry indicated by the (3S) configuration suggests specific spatial arrangements that can influence the compound's biological activity and interactions. This compound may exhibit properties typical of amides, such as moderate melting and boiling points, and it could participate in hydrogen bonding due to the hydroxyl group. Its unique structure may also suggest potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Overall, the combination of hydrophobic and hydrophilic elements in its structure makes it an interesting candidate for various chemical and biological applications.
Formula:C14H25NO4
InChI:InChI=1S/C14H25NO4/c1-2-3-4-5-6-7-11(16)10-13(17)15-12-8-9-19-14(12)18/h11-12,16H,2-10H2,1H3,(H,15,17)/t11?,12-/m0/s1
InChI key:DOICJCCMIBBSOO-KIYNQFGBSA-N
SMILES:CCCCCCCC(CC(=O)N[C@H]1CCOC1=O)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N-3-hydroxydecanoyl-L-Homoserine lactone
CAS:N-3-hydroxydecanoyl-L-Homoserine lactoneFormula:C14H25NO4Purity:≥95%Molecular weight:271.35Decanamide, 3-hydroxy-N-[(3S)-tetrahydro-2-oxo-3-furanyl]-
CAS:Formula:C14H25NO4Purity:98%Molecular weight:271.3526N-3-hydroxydecanoyl-L-Homoserine lactone
CAS:N-3-hydroxydecanoyl-L-Homoserine lactone, a bacterial signaling molecule, regulates gene expression, affecting quorum sensing and quenching.Formula:C14H25NO4Color and Shape:SolidMolecular weight:271.357N-3-Hydroxydecanoyl-L-homoserine Lactone
CAS:Controlled ProductApplications N-3-hydroxydecanoyl-L-homoserine Lactone is a small signaling molecule that is secreted by different types of gram-negative bacteria as a autoinducer. N-3-hydroxydecanoyl-L-homoserine Lactone has been used in studies involving interspecies signaling through QscR, a quorum receptor of pseudomonas aeruginosa.
References Chen, X., et al.: Anal. Bioanal. Chem., 398, 2655 (2010); Ha, C.W., et al.: Molec. Cells., 33, 53 (2012); Chan, K.G., et al.: BMC Microbiol., 11, 51 (2011);Formula:C14H25NO4Color and Shape:NeatMolecular weight:252.263






