CymitQuimica logo

CAS 19315-13-0

:

methyl(phenyl)phosphane oxide

Description:
Methyl(phenyl)phosphane oxide, with the CAS number 19315-13-0, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to a methyl group, a phenyl group, and an oxygen atom, which contributes to its phosphine oxide structure. This compound typically exhibits a polar nature due to the presence of the phosphine oxide functional group, which can engage in hydrogen bonding and dipole-dipole interactions. Methyl(phenyl)phosphane oxide is often used in organic synthesis and as a ligand in coordination chemistry due to its ability to coordinate with metal ions. It may also exhibit properties such as moderate volatility and solubility in organic solvents, making it useful in various chemical applications. Additionally, the presence of both methyl and phenyl groups can influence its reactivity and stability, allowing for diverse applications in pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as organophosphorus compounds can vary in toxicity and environmental impact.
Formula:C7H9OP
InChI:InChI=1/C7H9OP/c1-9(8)7-5-3-2-4-6-7/h2-6,9H,1H3
InChI key:CKUALXJYIMVFON-UHFFFAOYSA-N
SMILES:CP(=O)c1ccccc1
Synonyms:
  • Phosphorane, Methylphenyl-, Oxide
Found 3 products.