CymitQuimica logo

CAS 193475-66-0

:

FMOC-GLU(EDANS)-OH

Description:
FMOC-GLU(EDANS)-OH is a chemical compound that serves as a derivative of glutamic acid, modified for use in peptide synthesis and fluorescence applications. The FMOC (9-fluorenylmethoxycarbonyl) group is a common protecting group used in solid-phase peptide synthesis, allowing for selective deprotection during the synthesis process. The EDANS (5-((2-aminoethyl)amino)naphthalene-1-sulfonic acid) moiety is a fluorescent tag that enables the monitoring of peptide interactions and dynamics through fluorescence spectroscopy. This compound is characterized by its ability to undergo specific reactions typical of amino acids, such as peptide bond formation, while also exhibiting fluorescence properties due to the EDANS group. Its structure allows for the study of biochemical processes, including enzyme activity and protein interactions, making it valuable in research and development within biochemistry and molecular biology. The compound is typically handled under standard laboratory conditions, and its stability and reactivity are influenced by the presence of the FMOC and EDANS groups.
Formula:C32H31N3O8S
InChI:InChI=1S/C32H31N3O8S/c36-30(34-18-17-33-27-13-5-12-25-24(27)11-6-14-29(25)44(40,41)42)16-15-28(31(37)38)35-32(39)43-19-26-22-9-3-1-7-20(22)21-8-2-4-10-23(21)26/h1-14,26,28,33H,15-19H2,(H,34,36)(H,35,39)(H,37,38)(H,40,41,42)/t28-/m0/s1
InChI key:HPYLYODKLGEPPX-NDEPHWFRSA-N
SMILES:C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)NCCNC4=CC=CC5=C4C=CC=C5S(=O)(=O)O)C(=O)O
Found 6 products.