CAS 193693-95-7
:3-hydroxy-5-nitrobenzaldehyde
Description:
3-Hydroxy-5-nitrobenzaldehyde is an organic compound characterized by the presence of both a hydroxyl group (-OH) and a nitro group (-NO2) attached to a benzaldehyde structure. This compound features a benzene ring with a formyl group (-CHO) at one position and hydroxyl and nitro substituents at the meta and para positions, respectively. It is typically a yellow crystalline solid, exhibiting properties such as solubility in organic solvents and limited solubility in water. The presence of the nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and potential applications in organic synthesis, particularly in the development of dyes, pharmaceuticals, and agrochemicals. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting the compound's physical properties and interactions. As with many nitro-containing compounds, 3-hydroxy-5-nitrobenzaldehyde may exhibit biological activity, making it of interest in medicinal chemistry and research. Safety precautions should be taken when handling this compound due to potential toxicity associated with nitro groups.
Formula:C7H5NO4
InChI:InChI=1/C7H5NO4/c9-4-5-1-6(8(11)12)3-7(10)2-5/h1-4,10H
SMILES:c1c(cc(cc1N(=O)=O)O)C=O
Synonyms:- Benzaldehyde, 3-Hydroxy-5-Nitro-
- 3-Hydroxy-5-nitrobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Hydroxy-5-nitrobenzaldehyde
CAS:3-Hydroxy-5-nitrobenzaldehydeFormula:C7H5NO4Purity:95%Molecular weight:167.123-Hydroxy-5-nitrobenzaldehyde
CAS:Formula:C7H5NO4Purity:95%Color and Shape:SolidMolecular weight:167.11893-Hydroxy-5-nitrobenzaldehyde
CAS:3-Hydroxy-5-nitrobenzaldehydeFormula:C7H5NO4Purity:95%Molecular weight:167.123-Hydroxy-5-nitrobenzaldehyde
CAS:3-Hydroxy-5-nitrobenzaldehyde is a solvent that has been used as a probe to measure chloride concentration in multimedia. It can be used as a sensor and an algorithm to detect the colorimetric change of 3-hydroxy-5-nitrobenzaldehyde in the presence of chloride ions. This probe is also used in colorimetric tests for linker, nonpolar, and surfactant compounds. The 3-hydroxy-5-nitrobenzaldehyde oxime can be cleaved by UV light to produce an unstable nitronium ion that reacts with metal ions such as copper(II) or silver(I) to form an insoluble precipitate.Formula:C7H5NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:167.12 g/mol3-Hydroxy-5-nitrobenzaldehyde
CAS:Formula:C7H5NO4Purity:95%Color and Shape:SolidMolecular weight:167.12




