CymitQuimica logo

CAS 19395-40-5

:

2-Piperidineacetic acid, α-phenyl-, hydrochloride (1:1)

Description:
2-Piperidineacetic acid, α-phenyl-, hydrochloride (1:1), with the CAS number 19395-40-5, is a chemical compound that features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound is characterized by the presence of an acetic acid moiety and a phenyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The piperidine structure imparts basicity, while the carboxylic acid group provides acidic characteristics, allowing for potential interactions in biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 2-Piperidineacetic acid, α-phenyl-, hydrochloride is a versatile compound with potential applications in drug development and research.
Formula:C13H17NO2·ClH
InChI:InChI=1S/C13H17NO2.ClH/c15-13(16)12(10-6-2-1-3-7-10)11-8-4-5-9-14-11;/h1-3,6-7,11-12,14H,4-5,8-9H2,(H,15,16);1H
InChI key:InChIKey=SCUMDQFFZZGUQY-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC=CC=C1)C2CCCCN2.Cl
Synonyms:
  • 2-Piperidineacetic acid, α-phenyl-, hydrochloride
  • 2-Phenyl-2-(piperidin-2-yl)acetic acid hydrochloride
  • 2-Piperidineacetic acid, α-phenyl-, hydrochloride (1:1)
Found 9 products.