CAS 194019-11-9
:3-Bromo-4-fluorophenylacetic Acid
Description:
3-Bromo-4-fluorophenylacetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as a carboxylic acid functional group. The presence of the bromine and fluorine substituents can influence the compound's reactivity, polarity, and overall chemical behavior. Typically, such halogenated compounds exhibit unique properties, including altered solubility in various solvents and potential biological activity. The carboxylic acid group contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. This compound may be of interest in pharmaceutical research and development due to its potential applications in drug synthesis or as a building block in organic chemistry. Additionally, the specific arrangement of the bromine and fluorine atoms can affect the compound's electronic properties, making it a subject of study in materials science and medicinal chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose health risks.
Formula:C8H6BrFO2
InChI:InChI=1/C8H6BrFO2/c9-6-3-5(4-8(11)12)1-2-7(6)10/h1-3H,4H2,(H,11,12)
SMILES:c1cc(c(cc1CC(=O)O)Br)F
Synonyms:- (3-Bromo-4-fluorophenyl)acetic acid
- 2-(3-Bromo-4-Fluorophenyl)Acetic Acid
- 3-Bromo-4-fluorobenzeneacetic acid
- Benzeneacetic acid, 3-bromo-4-fluoro-
- Qv1R Df Ce
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-4-fluorophenylacetic Acid
CAS:Formula:C8H6BrFO2Purity:>97.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:233.043-Bromo-4-fluorophenylacetic acid
CAS:3-Bromo-4-fluorophenylacetic acidFormula:C8H6BrFO2Purity:98%Color and Shape:Pale yellow SolidMolecular weight:233.034443-BROMO-4-FLUOROPHENYLACETIC ACID
CAS:Formula:C8H6BrFO2Purity:98%Color and Shape:SolidMolecular weight:233.03443-Bromo-4-fluorophenylacetic acid
CAS:Formula:C8H6BrFO2Purity:98%Color and Shape:SolidMolecular weight:233.0363-Bromo-4-fluorophenylacetic acid
CAS:3-Bromo-4-fluorophenylacetic acidFormula:C8H6BrFO2Purity:97%Molecular weight:233.03




