CymitQuimica logo

CAS 1942114-09-1

:

EAI045

Description:
EAI045, with the CAS number 1942114-09-1, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its role as a selective inhibitor of the enzyme phosphoinositide 3-kinase (PI3K). This compound is characterized by its ability to modulate cellular signaling pathways, which are crucial for various biological processes, including cell growth, proliferation, and survival. EAI045 is often studied for its potential therapeutic applications in cancer treatment, as PI3K signaling is frequently dysregulated in tumors. The compound typically exhibits a specific binding affinity for the PI3K isoforms, which allows for targeted therapeutic strategies while minimizing off-target effects. In terms of its physical and chemical properties, EAI045 is expected to possess a defined molecular structure that contributes to its biological activity, although detailed information on its solubility, stability, and other physicochemical characteristics would require further investigation. Overall, EAI045 represents a promising candidate in the ongoing research into targeted cancer therapies.
Formula:C19H14FN3O3S
InChI:InChI=1S/C19H14FN3O3S/c20-12-5-6-15(24)14(9-12)16(17(25)22-19-21-7-8-27-19)23-10-11-3-1-2-4-13(11)18(23)26/h1-9,16,24H,10H2,(H,21,22,25)
InChI key:YTUFHOKUFOQRDF-UHFFFAOYSA-N
SMILES:C1C2=CC=CC=C2C(=O)N1C(C3=C(C=CC(=C3)F)O)C(=O)NC4=NC=CS4
Found 7 products.