CymitQuimica logo

CAS 194491-31-1

:

Ethylenediaminetetraacetic acid, tetrasodium salt hydrate

Description:
Ethylenediaminetetraacetic acid, tetrasodium salt hydrate, commonly referred to as EDTA tetrasodium salt, is a chelating agent widely used in various applications, including pharmaceuticals, agriculture, and food processing. This compound is characterized by its ability to form stable complexes with metal ions, effectively sequestering them and preventing undesirable reactions. The tetrasodium salt form enhances its solubility in water, making it suitable for use in aqueous solutions. Typically, it appears as a white crystalline powder and is hygroscopic, meaning it can absorb moisture from the environment. EDTA tetrasodium salt is non-toxic and biodegradable, which contributes to its popularity in environmentally friendly formulations. Its pH stability allows it to function effectively across a range of conditions, and it is often utilized in formulations to improve the stability and efficacy of active ingredients. Additionally, it plays a crucial role in analytical chemistry for metal ion determination and is used in various industrial processes to prevent metal ion interference.
Formula:C10H12N2Na4O8·xH2O
InChI:InChI=1S/C10H16N2O8.4Na.H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;;1H2/q;4*+1;/p-4
InChI key:GXFFSKMBMYHTAE-UHFFFAOYSA-J
SMILES:C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].O.[Na+].[Na+].[Na+].[Na+]
Synonyms:
  • EDTA tetrasodium salt hydrate
  • Ethylenediaminetetraacetic acid tetrasodium salt hydrate
Found 8 products.