CAS 1946010-79-2

Formula: C19H21ClF3N5O2

InChI: InChI=1S/C19H21ClF3N5O2/c1-12-11-30-5-4-26(12)16-7-17(29)27-3-2-15(19(21,22)23)28(18(27)25-16)10-13-6-14(20)9-24-8-13/h6-9,12,15H,2-5,10-11H2,1H3/t12-,15-/m1/s1

InChI key: SPDQRCUBFSRAFI-IUODEOHRSA-N

SMILES: C[C@@H]1COCCN1C2=CC(=O)N3CC[C@@H](N(C3=N2)CC4=CC(=CN=C4)Cl)C(F)(F)F

SAR405 R enantiomer

CAS: 1946010-79-2

SAR405 R enantiomer is the less active enantiomer of SAR405. SAR405 is an inhibitor of PIK3C3/Vps34.

Formula: C₁₉H₂₁ClF₃N₅O₂

Purity: 98.04%

Color and Shape: Solid

Molecular weight: 443.851

Ref: TM-T12831

SAR405 R enantiomer

CAS: 1946010-79-2

SAR405 R enantiomer

Formula: C₁₉H₂₁ClF₃N₅O₂

Purity: ≥95%

Molecular weight: 443.85

Ref: 54-BUP08790

(R)-1-((5-Chloropyridin-3-yl)methyl)-8-((R)-3-methylmorpholino)-2-(trifluoromethyl)-3,4-dihydro-1H-pyrimido[1,2-a]pyrimidin-6(2H)-one

CAS: 1946010-79-2

Formula: C₁₉H₂₁ClF₃N₅O₂

Purity: 98.04%

Molecular weight: 443.8505

Ref: IN-DA01EBPS

Sar405 R enantiomer

CAS: 1946010-79-2

Sar405 R enantiomer is a chiral small molecule compound, which is developed as a potent and selective inhibitor of the class III phosphatidylinositol 3-kinase (PI3K). This compound originates from synthetic chemical processes, designed to specifically target and modulate the PI3K pathway known for its critical role in autophagy, endocytosis, and various signaling processes within the cell.

Formula: C₁₉H₂₁ClF₃N₅O₂

Purity: Min. 95%

Molecular weight: 443.8 g/mol

Ref: 3D-WCD01079