CAS 19492-03-6
:8-Hydroxy-7-methoxy-2H-1-benzopyran-2-one
Description:
8-Hydroxy-7-methoxy-2H-1-benzopyran-2-one, also known by its CAS number 19492-03-6, is a chemical compound belonging to the class of flavonoids, specifically a type of coumarin. This compound features a benzopyran structure, characterized by a fused benzene and pyran ring, with hydroxyl and methoxy substituents that contribute to its chemical properties. It typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. The presence of the hydroxyl group enhances its potential for hydrogen bonding, which can influence its reactivity and interaction with biological systems. This compound is of interest in various fields, including medicinal chemistry and natural product research, due to its potential antioxidant, anti-inflammatory, and antimicrobial activities. Its structural features may also allow for further derivatization, leading to the development of novel compounds with enhanced biological activities. As with many flavonoids, it may play a role in plant defense mechanisms and has been studied for its potential health benefits in humans.
Formula:C10H8O4
InChI:InChI=1S/C10H8O4/c1-13-7-4-2-6-3-5-8(11)14-10(6)9(7)12/h2-5,12H,1H3
InChI key:InChIKey=KIGCGZUAVODHMD-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC=C1OC)C=CC(=O)O2
Synonyms:- 2H-1-Benzopyran-2-one, 8-hydroxy-7-methoxy-
- 7-Methoxy-8-hydroxycoumarin
- 8-Hydroxy-7-methoxy-2H-1-benzopyran-2-one
- 8-hydroxy-7-methoxy-2H-chromen-2-one
- Coumarin, 8-hydroxy-7-methoxy-
- Daphnetin 7-methyl ether
- Herniarin, 8-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Daphnetin-7-methylether
CAS:Daphnetin-7-methylether analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C10H8O4Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:192.178-Hydroxy-7-methoxycoumarin
CAS:8-Hydroxy-7-methoxycoumarinFormula:C10H8O4Purity:≥95%Molecular weight:192.168128-Hydroxy-7-methoxycoumarin
CAS:Daphnetin 7-methyl ether has anti-inflammatory activity.Formula:C10H8O4Purity:98%Color and Shape:SolidMolecular weight:192.17Daphnetin 7-methyl ether
CAS:Formula:C10H8O4Purity:95%~99%Color and Shape:Cryst.Molecular weight:192.178-Hydroxy-7-methoxycoumarin
CAS:8-Hydroxy-7-methoxycoumarin is a fluorescent compound, which is a derivative of the coumarin family. This compound is typically sourced through synthetic organic chemistry processes involving the modification of natural coumarin compounds. Its mode of action involves the ability to absorb ultraviolet light and re-emit it as visible light, a characteristic feature of fluorescent molecules. This property makes it particularly useful in scientific research.
Formula:C10H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:192.17 g/mol






