CymitQuimica logo

CAS 1949836-86-5

:

5-Cyclopropyl-3-(2-thienyl)-1H-pyrazole-1-acetonitrile

Description:
5-Cyclopropyl-3-(2-thienyl)-1H-pyrazole-1-acetonitrile is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a cyclopropyl group, and a thienyl substituent. The presence of the cyano group (acetonitrile) contributes to its reactivity and potential applications in various chemical reactions. This compound is likely to exhibit properties typical of heterocyclic compounds, such as moderate to high polarity due to the presence of electronegative atoms in the thienyl and cyano groups. Additionally, the cyclopropyl moiety may impart unique steric and electronic properties, influencing its behavior in biological or chemical systems. The compound's potential applications could span medicinal chemistry, agrochemicals, or materials science, depending on its biological activity and stability. As with many pyrazole derivatives, it may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H11N3S
InChI:InChI=1S/C12H11N3S/c13-5-6-15-11(9-3-4-9)8-10(14-15)12-2-1-7-16-12/h1-2,7-9H,3-4,6H2
InChI key:InChIKey=ZZOFCESMGSQAPC-UHFFFAOYSA-N
SMILES:C(C#N)N1C(=CC(=N1)C2=CC=CS2)C3CC3
Synonyms:
  • 1H-Pyrazole-1-acetonitrile, 5-cyclopropyl-3-(2-thienyl)-
  • 5-Cyclopropyl-3-(2-thienyl)-1H-pyrazole-1-acetonitrile
Found 1 products.