CAS 1951-12-8
:3-Chlorobutanoic acid
Description:
3-Chlorobutanoic acid is a chlorinated carboxylic acid characterized by the presence of a chlorine atom at the third carbon of a four-carbon butanoic acid chain. Its molecular formula is C4H7ClO2, and it features a carboxylic acid functional group (-COOH) that imparts acidic properties. This compound is typically a colorless to pale yellow liquid with a pungent odor. It is soluble in water and organic solvents, making it versatile for various chemical reactions. The presence of the chlorine atom enhances its reactivity, allowing it to participate in nucleophilic substitution reactions and other transformations. 3-Chlorobutanoic acid is used in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Safety considerations include handling it with care due to its corrosive nature and potential health hazards associated with exposure. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory and industrial settings.
Formula:C4H7ClO2
InChI:InChI=1S/C4H7ClO2/c1-3(5)2-4(6)7/h3H,2H2,1H3,(H,6,7)
InChI key:InChIKey=XEEMVPPCXNTVNP-UHFFFAOYSA-N
SMILES:C(C(C)Cl)C(O)=O
Synonyms:- (3S)-3-chlorobutanoic acid
- 3-Chlorobutanoic acid
- 3-Chlorobutyric acid
- Brn 1720571
- Butanoic acid, 3-chloro-
- Butyric acid, 3-chloro-
- Butyric acid, β-chloro-
- Nsc 404459
- beta-Chlorobutyric acid
- β-Chlorobutyric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Chlorobutyric Acid
CAS:Formula:C4H7ClO2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:122.553-Chloro-n-butyric acid
CAS:Formula:C4H7ClO2Purity:98.0%Color and Shape:LiquidMolecular weight:122.553-Chlorobutyric acid
CAS:3-Chlorobutyric acid is a chemical that has been shown to stabilize amines and other nucleophiles. It can be synthesized in the presence of 3-bromopropylamine hydrobromide, acyl halides, chloride, and aluminum. The reaction vessel must contain a carbon source for this synthesis to occur. The nmr spectra of 3-chlorobutyric acid show peaks at 2.00 ppm for the methylene hydrogen; 1.09 ppm for the methyl proton; 0.84 ppm for the methylene proton; and 0.65 ppm for the methyl proton of the carboxylic acid group. Hydrogen chloride gas is used as a reactant in this synthesis process and is released as a byproduct during the reaction process.Formula:C4H7ClO2Purity:Min. 95%Molecular weight:122.55 g/mol





