CymitQuimica logo

CAS 1951425-23-2

:

(S)-2-Amino-2-(3-fluoro-2-methylphenyl)ethanol hydrochloride

Description:
(S)-2-Amino-2-(3-fluoro-2-methylphenyl)ethanol hydrochloride is a chiral compound characterized by its amino alcohol structure, which features a hydroxyl group (-OH) and an amino group (-NH2) attached to a carbon chain. The presence of a fluorine atom on the aromatic ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, including pharmaceutical formulations. The chiral nature of the molecule suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to its chemical nature, and it is essential to consult material safety data sheets (MSDS) for detailed information.
Formula:C9H13ClFNO
InChI:InChI=1S/C9H12FNO.ClH/c1-6-7(9(11)5-12)3-2-4-8(6)10;/h2-4,9,12H,5,11H2,1H3;1H/t9-;/m1./s1
InChI key:ZBQXUHCCNVLRHD-SBSPUUFOSA-N
SMILES:CC1=C(C=CC=C1F)[C@@H](CO)N.Cl
Synonyms:
  • (S)-2-Amino-2-(3-fluoro-2-methylphenyl)ethanol hydrochloride
  • (2S)-2-AMINO-2-(3-FLUORO-2-METHYLPHENYL)ETHAN-1-OL HYDROCHLRIDE
  • (S)-2-amino-2-(3-fluoro-2-methylphenyl)ethan-1-ol hydrochloride
Found 2 products.