CAS 19525-80-5

Decanoic acid, 3-hydroxy-, (R)-

Description:

Decanoic acid, 3-hydroxy-, (R)-, also known as (R)-3-hydroxydecanoic acid, is a chiral fatty acid characterized by a long hydrocarbon chain with a hydroxyl group at the third carbon position. It has a molecular formula that reflects its structure, containing both carbon and oxygen atoms. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature, and is soluble in organic solvents while exhibiting limited solubility in water due to its hydrophobic nature. The presence of the hydroxyl group imparts unique properties, such as the ability to participate in hydrogen bonding, which can influence its reactivity and interactions with other molecules. Decanoic acid derivatives are often studied for their potential applications in pharmaceuticals, food additives, and as surfactants. The (R)- configuration indicates its specific stereochemistry, which can be crucial for biological activity and interactions in various chemical environments. Overall, this compound is of interest in both industrial and research settings due to its functional properties and potential applications.

Formula: C₁₀H₂₀O₃

InChI: InChI=1S/C10H20O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/t9-/m1/s1

InChI key: FYSSBMZUBSBFJL-SECBINFHSA-N

SMILES: CCCCCCC[C@H](CC(=O)O)O

(R)-3-Hydroxydecanoic acid

CAS: 19525-80-5

(R)-3-Hydroxydecanoic acid

Formula: C₁₀H₂₀O₃

Purity: 95%

Molecular weight: 188.27

Ref: 54-OR1073434

(R)-3-Hydroxydecanoic acid

CAS: 19525-80-5

(R)-3-Hydroxydecanoic acid is a lipid utilized in the preparation of lipid nanoparticles (LNP) for drug delivery purposes.

Formula: C₁₀H₂₀O₃

Molecular weight: 188.26

Ref: TM-TCL-02364

(R)-3-Hydroxydecanoic Acid

CAS: 19525-80-5

Formula: C₁₀H₂₀O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.2640

Ref: IN-DA00B6YK

(R)-3-Hydroxydecanoic acid

CAS: 19525-80-5

(R)-3-Hydroxydecanoic acid

Formula: C₁₀H₂₀O₃

Purity: 95%

Molecular weight: 188.26

Ref: IN-DG714994

(R)-3-Hydroxydecanoic acid

CAS: 19525-80-5

(R)-3-Hydroxydecanoic acid is a fatty acid that belongs to the group of antimicrobial agents. It has been shown to inhibit the growth of P. aeruginosa in vitro, and to have anti-bacterial activity against gram-positive bacteria. The chemical structure of this compound is similar to that of cyclic lipopeptides, which are known for their antifungal and antibacterial properties. This compound has been shown to inhibit bacterial translocation in vivo, as well as prevent both gram-positive and gram-negative bacteria from attaching to the intestinal wall. (R)-3-Hydroxydecanoic acid also inhibits the production of inflammatory cytokines by human monocytes stimulated with lipopolysaccharide (LPS).

Formula: C₁₀H₂₀O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 188.26 g/mol

Ref: 3D-FH161450

3R-Hydroxycapric Acid

Controlled Product

CAS: 19525-80-5

Formula: C₁₀H₂₀O₃

Color and Shape: Neat

Molecular weight: 188.264

Ref: TR-H357865