CAS 19541-99-2

1-HYDROXYMETHYLBENZIMIDAZOLE

Description:

1-Hydroxymethylbenzimidazole is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a hydroxymethyl group (-CH2OH) attached to the nitrogen of the imidazole ring, which contributes to its reactivity and solubility in polar solvents. It is typically a white to off-white solid and is known for its role in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of the hydroxymethyl group can enhance its biological activity and interaction with other molecules. Additionally, 1-hydroxymethylbenzimidazole may exhibit properties such as moderate stability under standard conditions, but it can be sensitive to heat and light, which may affect its integrity. Its applications often extend to research in medicinal chemistry, where it may serve as a precursor or intermediate in the development of more complex compounds. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c11-6-10-5-9-7-3-1-2-4-8(7)10/h1-5,11H,6H2

SMILES: c1ccc2c(c1)ncn2CO

Synonyms:

• 1H-Benzo[D]Imidazol-1-Ylmethanol
• 1H-Benzimidazole-1-methanol(9CI)
• 1H-benzimidazol-1-ylmethanol

1H-Benzimidazol-1-ylmethanol

CAS: 19541-99-2

Formula: C₈H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA007RB1

1H-benzo[d]imidazol-1-ylmethanol

CAS: 19541-99-2

1H-benzo[d]imidazol-1-ylmethanol

Purity: ≥95%

Ref: 54-OR30425

(1H-Benzo[d]imidazol-1-yl)methanol

CAS: 19541-99-2

(1H-Benzo[d]imidazol-1-yl)methanol

Purity: 98%

Molecular weight: 148.16g/mol

Ref: 54-OR90899

(1H-Benzo[d]imidazol-1-yl)methanol

CAS: 19541-99-2

Formula: C₈H₈N₂O

Purity: 98%

Molecular weight: 148.165

Ref: 10-F336776