CymitQuimica logo

CAS 19541-99-2

:

1-HYDROXYMETHYLBENZIMIDAZOLE

Description:
1-Hydroxymethylbenzimidazole is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a hydroxymethyl group (-CH2OH) attached to the nitrogen of the imidazole ring, which contributes to its reactivity and solubility in polar solvents. It is typically a white to off-white solid and is known for its role in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of the hydroxymethyl group can enhance its biological activity and interaction with other molecules. Additionally, 1-hydroxymethylbenzimidazole may exhibit properties such as moderate stability under standard conditions, but it can be sensitive to heat and light, which may affect its integrity. Its applications often extend to research in medicinal chemistry, where it may serve as a precursor or intermediate in the development of more complex compounds. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c11-6-10-5-9-7-3-1-2-4-8(7)10/h1-5,11H,6H2
InChI key:IWCRZZKSGBFRSJ-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)ncn2CO
Synonyms:
  • 1H-Benzo[D]Imidazol-1-Ylmethanol
  • 1H-Benzimidazole-1-methanol(9CI)
  • 1H-benzimidazol-1-ylmethanol
Found 4 products.