CymitQuimica logo

CAS 19543-85-2

:

3-[(4-fluorophenyl)thio]propanoic acid

Description:
3-[(4-Fluorophenyl)thio]propanoic acid, with the CAS number 19543-85-2, is an organic compound characterized by the presence of a propanoic acid moiety linked to a 4-fluorophenylthio group. This compound features a sulfur atom that connects the phenyl ring, which is substituted with a fluorine atom, to the propanoic acid backbone. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The thioether linkage contributes to the compound's overall stability and reactivity. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and synthesis of novel materials. Its specific physical and chemical properties, such as solubility, melting point, and reactivity, would typically be determined through experimental methods or detailed literature studies.
Formula:C9H9FO2S
InChI:InChI=1/C9H9FO2S/c10-7-1-3-8(4-2-7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12)
InChI key:FDINPNNZXJHPKE-UHFFFAOYSA-N
SMILES:c1cc(ccc1F)SCCC(=O)O
Synonyms:
  • 3-[(4-Fluorophenyl)Sulfanyl]Propanoic Acid
Found 3 products.