CymitQuimica logo

CAS 1955514-32-5

:

Benzenemethanamine, 4-bromo-3-methyl-, hydrochloride (1:1)

Description:
Benzenemethanamine, 4-bromo-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a bromine atom and a methyl group. The presence of the amine functional group contributes to its basicity and potential reactivity in various chemical reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and chemical applications. This compound may exhibit properties such as moderate to high melting points and stability under standard conditions, although specific thermal and solubility characteristics can vary. Its bromine substitution may impart unique electronic properties, influencing its reactivity and interactions with other molecules. Due to its structural features, it may be of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic effects. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H10BrN·ClH
InChI:InChI=1S/C8H10BrN.ClH/c1-6-4-7(5-10)2-3-8(6)9;/h2-4H,5,10H2,1H3;1H
InChI key:InChIKey=ZKXAYXQUEHWTIC-UHFFFAOYSA-N
SMILES:C(N)C1=CC(C)=C(Br)C=C1.Cl
Synonyms:
  • (4-Bromo-3-methylphenyl)methanamine hydrochloride
  • Benzenemethanamine, 4-bromo-3-methyl-, hydrochloride (1:1)
Found 2 products.