CymitQuimica logo

CAS 1956-09-8

:

4-nitrophenyl caprate

Description:
4-Nitrophenyl caprate, with the CAS number 1956-09-8, is an organic compound that belongs to the class of esters. It is formed from the reaction of capric acid (a fatty acid) and 4-nitrophenol. This compound typically appears as a yellowish solid or liquid, depending on its purity and temperature. It is characterized by the presence of a nitro group (-NO2) attached to the phenyl ring, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and organic synthesis. The ester functional group (-COO-) in 4-nitrophenyl caprate is responsible for its ability to undergo hydrolysis, making it relevant in studies of enzymatic activity and drug delivery systems. Additionally, the compound may exhibit specific solubility properties in organic solvents, influencing its use in formulations. Safety data should be consulted, as nitro compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 4-nitrophenyl caprate serves as a useful intermediate in chemical research and industrial applications.
Formula:C16H23NO4
InChI:InChI=1S/C16H23NO4/c1-2-3-4-5-6-7-8-9-16(18)21-15-12-10-14(11-13-15)17(19)20/h10-13H,2-9H2,1H3
InChI key:RRNKCSIEGPOIKI-UHFFFAOYSA-N
SMILES:CCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]
Synonyms:
  • P-nitrophenyl caprate
  • 4-Nitrophenyl decanoate
Found 7 products.