CymitQuimica logo

CAS 1956328-33-8

:

7-Acetyl-3-quinolinecarboxylic acid

Description:
7-Acetyl-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. This compound features an acetyl group at the 7-position and a carboxylic acid functional group at the 3-position of the quinoline ring. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound may be synthesized through specific organic reactions, and its properties can be studied using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. Overall, 7-acetyl-3-quinolinecarboxylic acid represents a unique structure that may have applications in pharmaceuticals or as a chemical intermediate in organic synthesis.
Formula:C12H9NO3
InChI:InChI=1S/C12H9NO3/c1-7(14)8-2-3-9-4-10(12(15)16)6-13-11(9)5-8/h2-6H,1H3,(H,15,16)
InChI key:InChIKey=JORIAGSAUPSQET-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC2=C(C=C(C(C)=O)C=C2)N=C1
Synonyms:
  • 3-Quinolinecarboxylic acid, 7-acetyl-
  • 7-Acetyl-3-quinolinecarboxylic acid
Found 3 products.