CymitQuimica logo

CAS 195886-79-4

:

2-(Difluoromethyl)-1,4-difluorobenzene

Description:
2-(Difluoromethyl)-1,4-difluorobenzene, with the CAS number 195886-79-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two difluoromethyl groups and two fluorine atoms. This compound typically exhibits a high degree of stability due to the resonance of the aromatic system. The presence of multiple fluorine atoms contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in nucleophilic substitution reactions. It is generally non-polar, making it less soluble in water but more soluble in organic solvents. The difluoromethyl groups can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, due to the fluorine atoms, this compound may exhibit distinctive physical properties such as a higher boiling point compared to its non-fluorinated analogs. Its applications may span various fields, including pharmaceuticals and agrochemicals, where fluorinated compounds are often sought for their enhanced biological activity and stability.
Formula:C7H4F4
InChI:InChI=1S/C7H4F4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,7H
InChI key:FDUVCOVVYFCQEH-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1F)C(F)F)F
Synonyms:
  • 1,4-Difluoro-2-(difluoromethyl)benzene, alpha,alpha,2,5-Tetrafluorotoluene
  • 2-(Difluoromethyl)-1,4-difluorobenzene
  • 2,5-Difluorobenzal fluoride
  • Benzene, 2-(difluoromethyl)-1,4-difluoro-
Found 3 products.