CymitQuimica logo

CAS 19648-83-0

:

cobalt(ii) hexafluoroacetylacetonate

Description:
Cobalt(II) hexafluoroacetylacetonate, with the CAS number 19648-83-0, is a coordination compound featuring cobalt in the +2 oxidation state coordinated to hexafluoroacetylacetonate ligands. This compound typically appears as a blue or green solid and is known for its stability and solubility in organic solvents. The hexafluoroacetylacetonate ligand, derived from hexafluoroacetylacetone, is a bidentate ligand that forms stable chelate complexes with transition metals. Cobalt(II) hexafluoroacetylacetonate is often used in various applications, including catalysis, materials science, and as a precursor in the synthesis of cobalt-containing materials. Its unique electronic and magnetic properties make it of interest in research fields such as coordination chemistry and organometallic chemistry. Additionally, handling this compound requires caution due to the potential toxicity of cobalt and the fluorinated ligands, necessitating appropriate safety measures in laboratory settings.
Formula:C10H2CoF12O4
InChI:InChI=1/2C5H2F6O2.Co/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h2*1,12H;/q;;+2/p-2/b2*2-1-;
InChI key:BOMJMIRWVAOTFV-PAMPIZDHSA-N
SMILES:C(=C(C(F)(F)F)O)C(=O)C(F)(F)F.C(=C(C(F)(F)F)O)C(=O)C(F)(F)F.[Co]
Synonyms:
  • Cobalt(II) 1,1,1,5,5,5-hexafluoroacetylacetonate hydrate
  • Cobalthexafluoroacetylacetonate
  • Bis(1,1,1,5,5,5-hexafluoroacetylacetonato)cobalt(II)~Cobalt(II) 1,1,1,5,5,5-hexafluoro-2,4-pentanedionate
  • cobalt(2+) bis[(2Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate]
  • Cobalt (Ii) Hexafluoro-2,4-Pentanedionate
Found 5 products.