CymitQuimica logo

CAS 1965310-11-5

:

3-Furancarboxylic acid, 4-aminotetrahydro-, methyl ester, hydrochloride (1:1)

Description:
3-Furancarboxylic acid, 4-aminotetrahydro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a bioactive molecule. The presence of the methyl ester indicates that the carboxylic acid is esterified, which can influence its solubility and reactivity. The hydrochloride form suggests that the compound is a salt, enhancing its stability and solubility in aqueous environments. This compound may exhibit various biological activities, making it of interest in pharmaceutical and medicinal chemistry. Its molecular interactions can be influenced by the functional groups present, allowing for potential applications in drug development or as a biochemical probe. As with many compounds, safety and handling precautions should be observed, particularly due to the presence of the hydrochloride salt, which can be corrosive. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C6H11NO3·ClH
InChI:InChI=1S/C6H11NO3.ClH/c1-9-6(8)4-2-10-3-5(4)7;/h4-5H,2-3,7H2,1H3;1H
InChI key:InChIKey=HUQJAEXTMMVOBZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(N)COC1.Cl
Synonyms:
  • 3-Furancarboxylic acid, 4-aminotetrahydro-, methyl ester, hydrochloride (1:1)
Found 4 products.