CymitQuimica logo

CAS 196597-78-1

:

1,2,6,7-Tetrahydro-8H-indeno[5,4-b]furan-8-one

Description:
1,2,6,7-Tetrahydro-8H-indeno[5,4-b]furan-8-one is a bicyclic organic compound characterized by its unique fused ring structure, which includes both a furan and an indene moiety. This compound typically exhibits a pale yellow to brownish color and is known for its potential applications in organic synthesis and medicinal chemistry. It possesses a molecular formula that reflects its complex structure, contributing to its interesting chemical reactivity and properties. The presence of the furan ring suggests potential for electrophilic reactions, while the indene structure may impart stability and influence its interaction with biological systems. Additionally, this compound may exhibit various functional properties, such as fluorescence or specific binding affinities, making it of interest in research and development. Its CAS number, 196597-78-1, allows for precise identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, 1,2,6,7-Tetrahydro-8H-indeno[5,4-b]furan-8-one is a notable compound in the field of organic chemistry with diverse potential applications.
Formula:C11H10O2
InChI:InChI=1S/C11H10O2/c12-9-3-1-7-2-4-10-8(11(7)9)5-6-13-10/h2,4H,1,3,5-6H2
InChI key:InChIKey=ZZUIZMWFNOKNLN-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C=CC2CC1)OCC3
Synonyms:
  • 1,2,6,7-Tetrahydro-8H-indeno[5,4-β]furan-8-one
  • 1,2,6,7-Tetrahydro-8H-indeno[5,4-b]furan-8-one
  • 6,7-Dihydro-1H-indeno[5,4-b]furan-8(2H)-one
  • 8H-Indeno[5,4-b]furan-8-one, 1,2,6,7-tetrahydro-
Found 9 products.