CymitQuimica logo

CAS 196611-19-5

:

Benzenemethanol, 2-amino--alpha-,3-dimethyl-

Description:
Benzenemethanol, 2-amino-alpha,3-dimethyl- is an organic compound characterized by its aromatic structure and the presence of both an amino group and a hydroxymethyl group. The compound features a benzene ring substituted with a hydroxymethyl group (–CH2OH) and an amino group (–NH2) at the 2-position, along with two methyl groups (–CH3) at the 3 and 4 positions of the benzene ring. This substitution pattern contributes to its unique chemical properties, including potential solubility in polar solvents due to the hydroxymethyl group and the ability to participate in hydrogen bonding. The amino group can act as a weak base, allowing the compound to engage in various chemical reactions, such as nucleophilic substitutions. Additionally, the presence of multiple functional groups may influence its reactivity and interactions with biological systems, making it of interest in medicinal chemistry and organic synthesis. Overall, this compound exemplifies the complexity and versatility of substituted aromatic compounds in organic chemistry.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-6-4-3-5-8(7(2)11)9(6)10/h3-5,7,11H,10H2,1-2H3
InChI key:RNQMERCPVXXHIB-UHFFFAOYSA-N
SMILES:CC1=C(C(=CC=C1)C(C)O)N
Found 5 products.