CAS 19668-85-0
:3-methyl-5-isoxazoleacetic acid
Description:
3-Methyl-5-isoxazoleacetic acid is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance is known for its role as a biochemical agent, particularly in the field of neuroscience, where it acts as a selective agonist for certain glutamate receptors. Its molecular structure includes a methyl group at the 3-position and a carboxylic acid functional group, contributing to its acidic properties. The compound is typically soluble in polar solvents, which facilitates its interaction with biological systems. Additionally, 3-methyl-5-isoxazoleacetic acid has been studied for its potential therapeutic applications, including neuroprotective effects and modulation of synaptic transmission. Its CAS number, 19668-85-0, is a unique identifier that aids in the cataloging and identification of this compound in chemical databases. Overall, this substance exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining biological activity.
Formula:C6H7NO3
InChI:InChI=1/C6H7NO3/c1-4-2-5(10-7-4)3-6(8)9/h2H,3H2,1H3,(H,8,9)
SMILES:Cc1cc(CC(=O)O)on1
Synonyms:- (3-Methylisoxazol-5-Yl)Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(3-methyl-isoxazol-5-yl)-acetic acid
CAS:Formula:C6H7NO3Purity:98%Color and Shape:SolidMolecular weight:141.1247(3-Methylisoxazol-5-yl)acetic acid
CAS:(3-Methylisoxazol-5-yl)acetic acidFormula:C6H7NO3Purity:98%Color and Shape:Brown Solid-PowderMolecular weight:141.124683-Methylisoxazole-5-acetic Acid
CAS:3-Methylisoxazole-5-acetic AcidFormula:C6H7NO3Purity:98%Molecular weight:141.123-Methyl-5-isoxazoleacetic acid
CAS:Please enquire for more information about 3-Methyl-5-isoxazoleacetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C6H7NO3Purity:Min. 95%Molecular weight:141.12 g/mol3-Methyl-5-isoxazoleacetic acid
CAS:Formula:C6H7NO3Purity:97%Color and Shape:SolidMolecular weight:141.126




