CymitQuimica logo

CAS 196862-45-0

:

5H-Pyrrolo[1,2-a]imidazol-6-ol,6,7-dihydro-,(R)-(9CI)

Description:
5H-Pyrrolo[1,2-a]imidazol-6-ol, 6,7-dihydro-, (R)-(9CI) is a heterocyclic organic compound characterized by its fused pyrrole and imidazole rings. This compound features a hydroxyl group at the 6-position, contributing to its potential as a bioactive molecule. The presence of the dihydro configuration indicates that it has two additional hydrogen atoms, which can influence its reactivity and stability. The (R) designation refers to its specific stereochemistry, which can affect its biological activity and interactions with other molecules. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that allow for diverse interactions with biological targets. Its CAS number, 196862-45-0, provides a unique identifier for regulatory and research purposes. Overall, the characteristics of this compound suggest potential applications in various fields, including drug discovery and development, although specific biological activities would require further investigation.
Formula:C6H8N2O
InChI:InChI=1S/C6H8N2O/c9-5-3-6-7-1-2-8(6)4-5/h1-2,5,9H,3-4H2/t5-/m1/s1
InChI key:OLXNUSXUUWAEGE-RXMQYKEDSA-N
SMILES:C1[C@H](CN2C1=NC=C2)O
Found 4 products.