CymitQuimica logo

CAS 19713-49-6

:

Anthracene, 9-ethyl-10-methyl-

Description:
Anthracene, 9-ethyl-10-methyl- (CAS 19713-49-6) is a polycyclic aromatic hydrocarbon (PAH) characterized by its structure, which consists of three fused benzene rings with ethyl and methyl substituents at the 9 and 10 positions, respectively. This compound typically appears as a solid, exhibiting a crystalline form with a color that can range from white to pale yellow. It is relatively insoluble in water but soluble in organic solvents such as benzene, toluene, and chloroform. Anthracene derivatives, including this compound, are known for their fluorescence properties, making them of interest in various applications, including organic electronics and as fluorescent probes. The presence of alkyl groups can influence its physical and chemical properties, such as melting point, boiling point, and reactivity. Additionally, like other PAHs, it may pose environmental and health risks, necessitating careful handling and consideration of its potential effects.
Formula:C17H16
InChI:InChI=1S/C17H16/c1-3-13-16-10-6-4-8-14(16)12(2)15-9-5-7-11-17(13)15/h4-11H,3H2,1-2H3
InChI key:KLSBNPSLEGBUSK-UHFFFAOYSA-N
SMILES:CCC1=C2C=CC=CC2=C(C3=CC=CC=C31)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.