CAS 197227-39-7

(2E)-3-(3,4-Dihydroxy-2-methoxyphenyl)-1-(3,4-dihydroxyphenyl)-2-propen-1-one

Description:

The chemical substance known as (2E)-3-(3,4-Dihydroxy-2-methoxyphenyl)-1-(3,4-dihydroxyphenyl)-2-propen-1-one, with the CAS number 197227-39-7, is a synthetic compound that belongs to the class of chalcones. Chalcones are characterized by their open-chain structure, which consists of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. This particular compound features multiple hydroxyl groups and a methoxy group, which contribute to its potential biological activity, including antioxidant and anti-inflammatory properties. The presence of these functional groups can enhance its solubility and reactivity, making it of interest in medicinal chemistry. Additionally, the compound's structural features suggest that it may interact with various biological targets, potentially leading to therapeutic applications. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and pharmaceutical contexts. Overall, this compound exemplifies the diverse chemistry of flavonoid derivatives and their potential utility in drug development.

Formula: C₁₆H₁₄O₆

InChI: InChI=1S/C16H14O6/c1-22-16-9(3-7-13(19)15(16)21)2-5-11(17)10-4-6-12(18)14(20)8-10/h2-8,18-21H,1H3/b5-2+

InChI key: InChIKey=BICPGUILWBQAEY-GORDUTHDSA-N

SMILES: C(=C/C(=O)C1=CC(O)=C(O)C=C1)\C2=C(OC)C(O)=C(O)C=C2

Synonyms:

• 2-Propen-1-one, 3-(3,4-dihydroxy-2-methoxyphenyl)-1-(3,4-dihydroxyphenyl)-, (E)-
• 2-Propen-1-one, 3-(3,4-dihydroxy-2-methoxyphenyl)-1-(3,4-dihydroxyphenyl)-, (2E)-
• (2E)-3-(3,4-Dihydroxy-2-methoxyphenyl)-1-(3,4-dihydroxyphenyl)-2-propen-1-one

Tetrahydroxymethoxychalcone

CAS: 197227-39-7

Tetrahydroxymethoxychalcone

Formula: C₁₆H₁₄O₆

Purity: 99%

Molecular weight: 302.28

Ref: 54-OR1105011

Tetrahydroxymethoxychalcone

CAS: 197227-39-7

Formula: C₁₆H₁₄O₆

Purity: 95%~99%

Molecular weight: 302.282

Ref: BP-BP5688

Tetrahydroxymethoxychalcone

CAS: 197227-39-7

Formula: C₁₆H₁₄O₆

Purity: 98%

Molecular weight: 302.2788

Ref: IN-DA00AQLJ

Tetrahydroxymethoxychalcone

CAS: 197227-39-7

Tetrahydroxymethoxychalcone is a synthetic flavonoid derivative, which is a compound typically found in plants with antioxidant properties. It is derived from chalcones, a type of natural phenolic compound often biosynthesized in various plant species. Tetrahydroxymethoxychalcone works primarily by inhibiting the enzyme tyrosinase, which is crucial in the biosynthesis of melanin. This mode of action suggests potential applications in cosmetic formulations aimed at skin depigmentation and lightening.

Formula: C₁₆H₁₄O₆

Purity: Min. 95%

Molecular weight: 302.28 g/mol

Ref: 3D-XHA22739