CAS 19746-40-8

N-acetyl-L-leucine P-nitroanilide

Description:

N-acetyl-L-leucine P-nitroanilide is a synthetic compound commonly used in biochemical research, particularly as a substrate in enzyme assays. It is characterized by its structure, which includes an N-acetyl group attached to the amino acid leucine, along with a P-nitroanilide moiety. This compound is typically a white to off-white solid and is soluble in organic solvents, making it suitable for various laboratory applications. Its primary use lies in its ability to undergo hydrolysis in the presence of specific enzymes, leading to the release of the P-nitroaniline product, which can be quantitatively measured. This property makes it valuable for studying proteolytic enzymes and assessing their activity. Additionally, the presence of the nitro group in the aniline portion contributes to its spectroscopic properties, allowing for easy detection and quantification. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure.

Formula: C₁₄H₁₉N₃O₄

InChI: InChI=1S/C14H19N3O4/c1-9(2)8-13(15-10(3)18)14(19)16-11-4-6-12(7-5-11)17(20)21/h4-7,9,13H,8H2,1-3H3,(H,15,18)(H,16,19)/t13-/m0/s1

InChI key: SLJKQHDBYBGOMH-ZDUSSCGKSA-N

SMILES: CC(C)C[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)C

Synonyms:

• Ac-Leu-pNA

(S)-2-Acetamido-4-methyl-N-(4-nitrophenyl)pentanamide

CAS: 19746-40-8

(S)-2-Acetamido-4-methyl-N-(4-nitrophenyl)pentanamide

Formula: C₁₄H₁₉N₃O₄

Purity: 98%

Molecular weight: 293.32

Ref: 54-OR1154991

Acetyl-L-leucine 4-nitroanilide

CAS: 19746-40-8

Molecular weight: 293.32

Ref: 7W-GM4093

(S)-2-Acetamido-4-methyl-N-(4-nitrophenyl)pentanamide

CAS: 19746-40-8

Formula: C₁₄H₁₉N₃O₄

Purity: 98%

Molecular weight: 293.3184

Ref: IN-DA002ATW

Ac-Leu-pNA

CAS: 19746-40-8

Ac-Leu-pNA is a peptide that is isolated from pyrococcus furiosus. It has the ability to inhibit serine proteases, including trypsin and chymotrypsin, by forming hydrogen bonds with their active site. Ac-Leu-pNA also inhibits the activity of the enzyme proteasome, which breaks down proteins in cells. This inhibition is due to its ability to bind to the ubiquitin-proteasome system (UPS) and block the enzymatic reaction. Ac-Leu-pNA has been shown to have a blood pressure lowering effect in humans.

Formula: C₁₄H₁₉N₃O₄

Purity: Min. 95%

Molecular weight: 293.32 g/mol

Ref: 3D-FA110696