CAS 1975-53-7
:Benzoic acid, 4-cyano-2-methyl-
Description:
4-Cyano-2-methylbenzoic acid, with the CAS number 1975-53-7, is an aromatic carboxylic acid characterized by the presence of both a cyano group (-CN) and a methyl group (-CH3) attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and acetone. The presence of the cyano group contributes to its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The compound exhibits typical acid properties, including the ability to donate protons in solution, which can influence its behavior in chemical reactions. Additionally, it may participate in hydrogen bonding due to the carboxylic acid functional group, affecting its physical properties and interactions with other molecules. Overall, 4-cyano-2-methylbenzoic acid is a versatile compound with significant utility in organic chemistry.
Formula:C9H7NO2
InChI:InChI=1S/C9H7NO2/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4H,1H3,(H,11,12)
InChI key:NIDKGLRXRBFGEN-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)C#N)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Cyano-2-methylbenzoic acid
CAS:Formula:C9H7NO2Purity:96%Color and Shape:SolidMolecular weight:161.15744-Cyano-2-methylbenzoic acid
CAS:4-Cyano-2-methylbenzoic acidFormula:C9H7NO2Purity:98%Color and Shape:SolidMolecular weight:161.157384-Cyano-2-methylbenzoic acid
CAS:Formula:C9H7NO2Purity:97%Color and Shape:SolidMolecular weight:161.164-Cyano-2-methylbenzoic acid
CAS:4-Cyano-2-methylbenzoic acidFormula:C9H7NO2Purity:98%Molecular weight:161.164-Cyano-2-methylbenzoic acid
CAS:4-Cyano-2-methylbenzoic acid is an organic compound with the formula CH3CNOC(O)CH2CO2H. It is a white, water soluble solid that is an intermediate in the conversion of 4-cyanoacetophenone to methyl benzoate. The compound has been used in research as an oxime and has shown biological activity against viruses, bacteria, and tumors. As a result of its antiviral activity, 4-Cyano-2-methylbenzoic acid has been studied for treatment of HIV/AIDS patients. The compound also inhibits insect growth by inhibiting chitin production and can be used as a pesticide or acaricide.Formula:C9H7NO2Purity:Min. 95%Molecular weight:161.16 g/mol




