CymitQuimica logo

CAS 197569-11-2

:

tert-butyl4-(cyanomethylene)piperidine-1-carboxylate

Description:
Tert-butyl 4-(cyanomethylene)piperidine-1-carboxylate is a chemical compound characterized by its piperidine structure, which includes a tert-butyl group and a cyanomethylene substituent. This compound typically exhibits properties associated with both piperidine derivatives and carboxylate esters. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of the tert-butyl group, which enhances hydrophobic interactions. The cyanomethylene group introduces a nitrile functionality, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by the electronic effects of the substituents, and it may be sensitive to hydrolysis under certain conditions. Overall, tert-butyl 4-(cyanomethylene)piperidine-1-carboxylate is a versatile compound with potential applications in organic synthesis and pharmaceutical development.
Formula:C12H18N2O2
InChI:InChI=1S/C12H18N2O2/c1-12(2,3)16-11(15)14-8-5-10(4-7-13)6-9-14/h4H,5-6,8-9H2,1-3H3
InChI key:BXCZVPSAYHBSQZ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(=CC#N)CC1
Found 5 products.