CAS 19788-49-9
:Ethyl 2-mercaptopropionate
Description:
Ethyl 2-mercaptopropionate, with the CAS number 19788-49-9, is an organic compound characterized by the presence of both an ethyl ester and a thiol functional group. It typically appears as a colorless to pale yellow liquid with a strong, sulfurous odor. This compound is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic ethyl group. Ethyl 2-mercaptopropionate is known for its reactivity, particularly in nucleophilic substitution reactions, owing to the thiol group, which can participate in various chemical transformations. It is often used in organic synthesis and as a building block in the production of more complex molecules. Additionally, it may have applications in the flavor and fragrance industry due to its distinctive odor profile. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it can be irritating to the skin and eyes. Overall, its unique chemical structure and properties make it a valuable compound in various chemical applications.
Formula:C5H10O2S
InChI:InChI=1S/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3
InChI key:InChIKey=LXXNWCFBZHKFPT-UHFFFAOYSA-N
SMILES:C(OCC)(C(C)S)=O
Synonyms:- 2-Mercaptopropanoic acid ethyl ester
- 2-Mercaptopropionic acid ethyl ester
- Ethyl 2-Sulfanylpropanoate
- Ethyl 2-mercaptopropanoate
- Ethyl 2-mercaptopropionate
- Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester
- Ethyl α-mercaptopropionate
- Propanoic acid, 2-mercapto-, ethyl ester
- Propionic acid, 2-mercapto-, ethyl ester
- α-Mercaptopropionic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 2-Mercaptopropionate
CAS:Formula:C5H10O2SPurity:>97.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:134.19Ethyl 2-Mercaptopropanoate
CAS:Ethyl 2-MercaptopropanoateFormula:C5H10O2SPurity:98%Color and Shape:LiquidMolecular weight:134.2Propanoic acid, 2-mercapto-, ethyl ester
CAS:Formula:C5H10O2SPurity:97%Color and Shape:LiquidMolecular weight:134.1967Ethyl 2-sulfanylpropanoate
CAS:Ethyl 2-sulfanylpropanoate is an organic ester containing a thio group that is used in organic synthesis and biochemical experiments.Formula:C5H10O2SColor and Shape:SolidMolecular weight:134.2Ethyl 2-Mercaptopropionate
CAS:Formula:C5H10O2SPurity:≥90%Color and Shape:ClearMolecular weight:134.19




