CymitQuimica logo

CAS 1979-29-9

:

2-(trifluoromethoxy)benzoic acid

Description:
2-(Trifluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a trifluoromethoxy group (-O-CF3) attached to the benzene ring at the ortho position relative to the carboxylic acid (-COOH) functional group. This compound typically exhibits a white to off-white crystalline appearance and is known for its relatively high stability under standard conditions. The trifluoromethoxy group imparts unique electronic properties, enhancing the acidity of the carboxylic acid and influencing its reactivity in various chemical reactions. It is soluble in organic solvents and may exhibit limited solubility in water due to the hydrophobic nature of the trifluoromethyl group. This compound is of interest in medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, its fluorinated structure can contribute to enhanced biological activity and metabolic stability. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H4F3O3
InChI:InChI=1/C8H5F3O3/c9-8(10,11)14-6-4-2-1-3-5(6)7(12)13/h1-4H,(H,12,13)/p-1
InChI key:JMYSPFGUBNENSE-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C(=O)[O-])OC(F)(F)F
Synonyms:
  • 2-(Trifluoromethoxy)Benzoate
  • O-Trifluoromethoxybenzoic Acid
Found 5 products.