CAS 19817-88-0
:Hexanoylglucosamine
Description:
Hexanoylglucosamine, also known as N-hexanoyl-D-glucosamine, is an amide derivative of glucosamine, characterized by the presence of a hexanoyl group attached to the amino sugar. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic hexanoyl chain. Hexanoylglucosamine is notable for its potential applications in biochemistry and pharmaceuticals, particularly in the development of glycosylated compounds and as a building block in the synthesis of various bioactive molecules. Its structure allows for interactions with biological systems, making it of interest in studies related to cell signaling and metabolism. Additionally, it may exhibit antimicrobial properties, contributing to its relevance in cosmetic and therapeutic formulations. As with many chemical substances, handling should be conducted with care, adhering to safety guidelines to mitigate any potential hazards associated with its use.
Formula:C12H23NO6
InChI:InChI=1/C12H23NO6/c1-2-3-4-5-8(15)13-9-11(17)10(16)7(6-14)19-12(9)18/h7,9-12,14,16-18H,2-6H2,1H3,(H,13,15)/t7-,9-,10-,11-,12?/m1/s1
SMILES:CCCCCC(=N[C@@H]1[C@H]([C@@H]([C@@H](CO)OC1O)O)O)O
Synonyms:- N-Hexanoyl-D-glucosamine
- 2-deoxy-2-(hexanoylamino)-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Hexanoyl-D-glucosamine
CAS:Formula:C12H23NO6Purity:>98.0%(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:277.32N-Hexanoyl-D-glucosamine
CAS:N-Hexanoyl-D-glucosamineFormula:C12H23NO6Purity:>98.0%Molecular weight:277.32D-Glucose, 2-deoxy-2-[(1-oxohexyl)amino]-
CAS:Formula:C12H23NO6Purity:98.0%Color and Shape:SolidMolecular weight:277.3141N-Hexanoyl-D-glucosamine
CAS:N-Hexanoyl-D-glucosamine is a hexose sugar that is a component of the glycosaminoglycan heparin. It is structurally related to acetylglucosamine and n-acetylglucosamine, which are also components of heparin. N-Hexanoyl-D-glucosamine can be synthesized by the injection of propionylated D-glucose into animal tissues. The biosynthesis of this compound is impaired in animals with diabetes mellitus.Formula:C12H23NO6Purity:(%) Min. 98%Color and Shape:White PowderMolecular weight:277.31 g/mol




