CAS 19829-79-9
:Hydroxyquinolinecarboxylicacid; 98%
Description:
Hydroxyquinolinecarboxylic acid, with the CAS number 19829-79-9, is an organic compound characterized by the presence of both hydroxy and carboxylic acid functional groups attached to a quinoline structure. This compound typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and analytical chemistry. It exhibits properties such as solubility in polar solvents, which can facilitate its use in various chemical reactions and formulations. The presence of the hydroxy group contributes to its ability to form hydrogen bonds, enhancing its reactivity and interaction with other molecules. Additionally, hydroxyquinolinecarboxylic acid can act as a chelating agent, binding to metal ions, which is valuable in both biological systems and industrial processes. Its purity, often indicated as 98%, suggests a high level of quality suitable for research and application. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.
Formula:C12H11NO3
InChI:InChI=1/C12H11NO3/c1-2-16-12(15)9-6-5-8-4-3-7-13-10(8)11(9)14/h3-7,14H,2H2,1H3
SMILES:CCOC(=O)c1ccc2cccnc2c1O
Synonyms:- 8-Hydroxy-7-quinolinecarboxylic acid
- 8-Hydroxyquinoline-7-Carboxylic Acid
- Ethyl 8-Hydroxyquinoline-7-Carboxylate
- 8-Hydroxyquinoline-7-carboxylic
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
8-Hydroxyquinoline-7-carboxylic Acid
CAS:Formula:C10H7NO3Purity:>98.0%(GC)(T)Color and Shape:White - Yellow Solid FormMolecular weight:189.178-Hydroxyquinoline-7-carboxylic acid
CAS:8-Hydroxyquinoline-7-carboxylic acidFormula:C10H7NO3Purity:95%Color and Shape:SolidMolecular weight:189.167487-Quinolinecarboxylic acid, 8-hydroxy-
CAS:Formula:C10H7NO3Purity:97%Color and Shape:SolidMolecular weight:189.16758-Hydroxy-7-quinolinecarboxylic acid
CAS:Formula:C10H7NO3Purity:95%Color and Shape:Very pale yellow to pale reddish yellow powderMolecular weight:189.178-Hydroxy-7-quinolinecarboxylic acid
CAS:8-Hydroxy-7-quinolinecarboxylic acidFormula:C10H7NO3Purity:97%Molecular weight:189.178-Hydroxyquinoline-7-carboxylic Acid
CAS:Controlled ProductApplications 8-Hydroxyquinoline-7-carboxylic acid (cas# 19829-79-9) is a useful research chemical.
Formula:C10H7NO3Color and Shape:NeatMolecular weight:189.16





