
CAS 1985605-59-1
:Baloxavir
Description:
Baloxavir marboxil is an antiviral medication primarily used for the treatment of influenza. It functions as a polymerase acidic endonuclease inhibitor, disrupting the viral replication process by preventing the cap-dependent transcription of viral RNA. This mechanism of action distinguishes it from other antiviral agents, such as neuraminidase inhibitors. Baloxavir is administered orally and is notable for its single-dose regimen, which enhances patient compliance. The substance is characterized by its relatively low molecular weight and specific structural features that contribute to its efficacy against various strains of the influenza virus, including those resistant to other antiviral treatments. Baloxavir marboxil is prodrug, meaning it is metabolized in the body to its active form, which is responsible for its antiviral activity. Its safety profile includes common side effects such as headache and gastrointestinal disturbances, but it is generally well-tolerated. The development of baloxavir represents a significant advancement in influenza treatment, particularly in the context of emerging viral resistance.
Formula:C24H19F2N3O4S
InChI:InChI=1S/C24H19F2N3O4S/c25-16-6-5-13-15(20(16)26)12-34-18-4-2-1-3-14(18)21(13)29-19-11-33-10-9-27(19)24(32)22-23(31)17(30)7-8-28(22)29/h1-8,19,21,31H,9-12H2/t19-,21+/m1/s1
InChI key:FIDLLEYNNRGVFR-CTNGQTDRSA-N
SMILES:C1COC[C@@H]2N1C(=O)C3=C(C(=O)C=CN3N2[C@H]4C5=C(CSC6=CC=CC=C46)C(=C(C=C5)F)F)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 15 products.
Baloxavir
CAS:Baloxavir (S-033447) is a first-in-class cap-dependent endonuclease inhibitor of the influenza virus polymerase PA subunit.Formula:C24H19F2N3O4SPurity:99.26% - 99.94%Color and Shape:White SolidMolecular weight:483.49Ref: TM-T14495
1mg73.00€5mg161.00€1mL*10mM (DMSO)171.00€10mg246.00€25mg475.00€50mg603.00€100mg860.00€200mg1,161.00€(R)-12-((S)-7,8-Difluoro-6,11-Dihydrodibenzo[B,E]Thiepin-11-Yl)-7-Hydroxy-3,4,12,12A-Tetrahydro-1H-[1,4]Oxazino[3,4-C]Pyrido[2,1-F][1,2,4]Triazine-6,8-Dione
CAS:(R)-12-((S)-7,8-Difluoro-6,11-Dihydrodibenzo[B,E]Thiepin-11-Yl)-7-Hydroxy-3,4,12,12A-Tetrahydro-1H-[1,4]Oxazino[3,4-C]Pyrido[2,1-F][1,2,4]Triazine-6,8-DioneFormula:C24H19F2N3O4SPurity:97%Molecular weight:483.49Baloxavir
CAS:Formula:C24H19F2N3O4SPurity:≥ 98.0%Color and Shape:White to yellow solidMolecular weight:483.49Baloxavir-d5
CAS:Formula:C24H14D5F2N3O4SColor and Shape:White To Off-White SolidMolecular weight:488.52Baloxavir
CAS:(R)-12-((S)-7,8-Difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-yl)-7-hydroxy-3,4,12,12a-tetrahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dioneFormula:C24H19F2N3O4SPurity:97%Molecular weight:483.49Baloxavir-d4
CAS:Controlled ProductFormula:C25D4H16F2N2O4SColor and Shape:NeatMolecular weight:486.524Baloxavir
CAS:Baloxavir is an antiviral drug that belongs to the class of endonuclease inhibitors. The compound has been shown to inhibit the activity of influenza virus polymerase, which is necessary for viral replication. Baloxavir is a prodrug that is activated by esterases in the gastrointestinal tract and becomes baloxavir marboxil after hydrolysis. It has demonstrated antiviral activity against influenza A and B viruses with a mechanism of action distinct from oseltamivir, which inhibits the neuraminidase enzyme on the surface of influenza viruses.Formula:C26H21F2NO4SPurity:Min. 95%Molecular weight:481.51 g/mol










