CAS 198649-68-2
:2-(trifluoromethoxy)benzyl bromide
Description:
2-(Trifluoromethoxy)benzyl bromide is an organic compound characterized by its unique functional groups and structure. It features a benzyl group attached to a trifluoromethoxy substituent, which significantly influences its chemical properties. The presence of the trifluoromethoxy group enhances the compound's lipophilicity and can affect its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. The bromide moiety serves as a good leaving group, facilitating nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care due to potential toxicity and environmental concerns associated with halogenated compounds. Additionally, its unique electronic properties may allow for specific interactions in biological systems, making it a candidate for further research in drug development. As with all chemical substances, proper safety protocols should be followed when handling and storing this compound.
Formula:C8H6BrF3O
InChI:InChI=1/C8H6BrF3O/c9-5-6-3-1-2-4-7(6)13-8(10,11)12/h1-4H,5H2
SMILES:c1ccc(c(c1)CBr)OC(F)(F)F
Synonyms:- alpha-Bromo-2-(trifluoromethoxy)toluene
- 2-(Trifluoromethoxy)benzylbromide
- 1-(Bromomethyl)-2-(Trifluoromethoxy)Benzene
- Trifluoromethoxybenzylbromide
- 2-Trifluoromethoxybenzyl bromide
- 2-Trifluoromethoxy Benzyl Bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzene, 1-(bromomethyl)-2-(trifluoromethoxy)-
CAS:Formula:C8H6BrF3OPurity:96%Color and Shape:LiquidMolecular weight:255.03182-(Trifluoromethoxy)benzyl bromide
CAS:2-(Trifluoromethoxy)benzyl bromideFormula:C8H6BrF3OPurity:97%Color and Shape: clear. colourless liquidMolecular weight:255.03g/mol2-(Trifluoromethoxy)benzyl Bromide
CAS:Formula:C8H6BrF3OPurity:>98.0%(GC)Color and Shape:Light orange to Yellow to Green clear liquidMolecular weight:255.032-(Trifluoromethoxy)benzyl bromide
CAS:Formula:C8H6BrF3OPurity:95.0%Color and Shape:Liquid, Clear LiquidMolecular weight:255.0342-(Trifluoromethoxy)benzyl bromide
CAS:<p>2-(Trifluoromethoxy)benzyl bromide is a computational study of ionic liquids with substitutions. The viscosity of the liquid was found to be dependent on the size of the substituent and the number of substitutions. The compound was found to be selective for one isomer over another due to its different structural features. Experimental studies have shown that 2-(trifluoromethoxy)benzyl bromide has high permeability in ionic liquids, which is a desired property in ionic liquids. Advances in this field have led to new compounds and more knowledge about the properties of ionic liquids.</p>Purity:Min. 95%




