CymitQuimica logo

CAS 198649-68-2

:

2-(trifluoromethoxy)benzyl bromide

Description:
2-(Trifluoromethoxy)benzyl bromide is an organic compound characterized by its unique functional groups and structure. It features a benzyl group attached to a trifluoromethoxy substituent, which significantly influences its chemical properties. The presence of the trifluoromethoxy group enhances the compound's lipophilicity and can affect its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. The bromide moiety serves as a good leaving group, facilitating nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care due to potential toxicity and environmental concerns associated with halogenated compounds. Additionally, its unique electronic properties may allow for specific interactions in biological systems, making it a candidate for further research in drug development. As with all chemical substances, proper safety protocols should be followed when handling and storing this compound.
Formula:C8H6BrF3O
InChI:InChI=1/C8H6BrF3O/c9-5-6-3-1-2-4-7(6)13-8(10,11)12/h1-4H,5H2
InChI key:TUNSVUOTVLWNQT-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)CBr)OC(F)(F)F
Synonyms:
  • alpha-Bromo-2-(trifluoromethoxy)toluene
  • 2-(Trifluoromethoxy)benzylbromide
  • 1-(Bromomethyl)-2-(Trifluoromethoxy)Benzene
  • Trifluoromethoxybenzylbromide
  • 2-Trifluoromethoxybenzyl bromide
  • 2-Trifluoromethoxy Benzyl Bromide
Found 6 products.