CAS 19872-91-4
:Dimethyl 4-oxo-1,4-dihydro-2,6-pyridinedicarboxylate
Description:
Dimethyl 4-oxo-1,4-dihydro-2,6-pyridinedicarboxylate, with the CAS number 19872-91-4, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two carboxylate groups, which are esterified with methyl groups, contributing to its solubility in organic solvents. The presence of the keto group (4-oxo) and the dihydro configuration indicates that it is a saturated derivative of a pyridine, which can influence its reactivity and stability. Dimethyl 4-oxo-1,4-dihydro-2,6-pyridinedicarboxylate is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. As with many chemical substances, safety precautions should be observed when handling this compound due to potential toxicity or reactivity.
Formula:C9H9NO5
InChI:InChI=1S/C9H9NO5/c1-14-8(12)6-3-5(11)4-7(10-6)9(13)15-2/h3-4H,1-2H3,(H,10,11)
SMILES:COC(=O)c1cc(=O)cc(C(=O)OC)[nH]1
Synonyms:- Dimethyl 4-Hydroxypyridine-2,6-Dicarboxylate
- 4-Oxo-1H-pyridine-2,6-dicarboxylic acid dimethyl ester
- Dimethyl 4-oxo-1H-pyridine-2,6-dicarboxylate
- Dimethyl 4-Oxo-1,4-Dihydropyridine-2,6-Dicarboxylate
- 2,6-Dimethyl 4-hydroxypyridine-2,6-dicarboxylate
- 4-Hydroxy-pyridine-2,6-dicarboxylic acid dimethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethyl 4-Hydroxy-2,6-pyridinedicarboxylate Monohydrate
CAS:Formula:C9H9NO5·H2OPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:229.19Dimethyl 4-hydroxypyridine-2,6-dicarboxylate
CAS:Formula:C9H9NO5Purity:95%Color and Shape:Liquid, No data available.Molecular weight:211.1732,6-Pyridinedicarboxylic acid, 4-hydroxy-, 2,6-dimethyl ester
CAS:Formula:C9H9NO5Purity:97%Color and Shape:SolidMolecular weight:211.1715Dimethyl 4-hydroxypyridine-2,6-dicarboxylate
CAS:Dimethyl 4-hydroxypyridine-2,6-dicarboxylateFormula:C9H9NO5Purity:97%Color and Shape:LiquidMolecular weight:211.17dimethyl 4-oxo-1,4-dihydropyridine-2,6-dicarboxylate
CAS:Dimethyl 4-oxo-1,4-dihydropyridine-2,6-dicarboxylate is a histone deacetylase inhibitor. It binds to the active site of the enzyme's zinc atom and prevents the removal of acetyl groups from lysine residues on histones. Dimethyl 4-oxo-1,4-dihydropyridine-2,6-dicarboxylate stabilizes nucleosomal DNA in cells and prevents DNA damage. It is also an apoptotic agent that can induce cell death by inhibiting protein synthesis. This molecule has a protonated water molecule as a tautomer and two hydroxy groups that may be protonated or deprotonated depending on pH conditions. The sulfoxide group is susceptible to oxidation reactions.Formula:C9H9NO5Purity:Min. 95%Molecular weight:211.17 g/mol




