CAS 1990-77-8

Formula: C26H30O10

InChI: InChI=1S/C26H30O10/c1-13(27)35-25-19(29-3)7-15(8-20(25)30-4)23-17-11-34-24(18(17)12-33-23)16-9-21(31-5)26(36-14(2)28)22(10-16)32-6/h7-10,17-18,23-24H,11-12H2,1-6H3/t17-,18-,23+,24+/m0/s1

InChI key: FEDJEJQAGQWOHV-XZUXRINTSA-N

SMILES: CC(=O)OC1=C(C=C(C=C1OC)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C(=C4)OC)OC(=O)C)OC)OC

Phenol, 4,4'-[(1R,3aS,4R,6aS)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis[2,6-dimethoxy-, diacetate, rel- (9CI)

CAS: 1990-77-8

Formula: C₂₆H₃₀O₁₀

Purity: 98.0%

Molecular weight: 502.5104

Ref: IN-DA002BVM

Syringaresinol diacetate

CAS: 1990-77-8

Syringaresinol diacetate is a natural product for research related to life sciences. The catalog number is TN5083 and the CAS number is 1990-77-8.

Formula: C₂₆H₃₀O₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 502.5104

Ref: TM-TN5083

Syringaresinol diacetate

CAS: 1990-77-8

Formula: C₂₆H₃₀O₁₀

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 502.516

Ref: BP-SBP00405

Syringaresinol diacetate

CAS: 1990-77-8

Syringaresinol diacetate is a chemical compound classified as a lignan derivative, which is typically sourced from plant materials. Lignans are a group of polyphenolic substances known for their potential health benefits and can be found in various plant species, particularly in seeds such as flaxseed, as well as in grains, vegetables, and fruits. The compound's mode of action primarily involves interacting with biological receptors and enzymes, modulating biochemical pathways linked to oxidative stress, cellular growth, and hormone regulation.

Formula: C₂₆H₃₀O₁₀

Purity: Min. 95%

Molecular weight: 502.5 g/mol

Ref: 3D-BAA99077