CymitQuimica logo

CAS 19905-58-9

:

stearic-2,2-D2 acid

Description:
Stearic-2,2-D2 acid, with the CAS number 19905-58-9, is a deuterated form of stearic acid, a long-chain saturated fatty acid. Its molecular formula is C18H36O2, but the presence of deuterium (D) in the structure indicates that some hydrogen atoms are replaced by deuterium isotopes, which are heavier than regular hydrogen. This modification can influence the physical and chemical properties of the compound, such as its melting point and solubility. Stearic acid itself is known for its waxy texture and is commonly found in animal and vegetable fats. It is used in various applications, including cosmetics, food, and pharmaceuticals, primarily as an emulsifier, thickening agent, or lubricant. The deuterated version is particularly valuable in research and analytical chemistry, especially in studies involving nuclear magnetic resonance (NMR) spectroscopy, where the distinct nuclear properties of deuterium can provide insights into molecular dynamics and interactions. Overall, stearic-2,2-D2 acid retains the characteristics of stearic acid while offering unique advantages for scientific applications.
Formula:C18H34D2O2
InChI:InChI=1/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i17D2
InChI key:QIQXTHQIDYTFRH-FBCWWBABSA-N
SMILES:CCCCCCCCCCCCCCCCC(C(=O)O)([2H])[2H]
Synonyms:
  • 2,2-Dideuteriooctadecanoic Acid
Found 6 products.