CAS 19914-20-6
:enniatin B1
Description:
Enniatin B1 is a cyclic hexadepsipeptide belonging to the enniatin family, which are produced by certain species of fungi, particularly those in the Fusarium genus. This compound is characterized by its unique structure, which consists of alternating amino acid and hydroxy acid residues, forming a cyclic arrangement. Enniatin B1 exhibits notable biological activity, including antifungal and antibacterial properties, making it of interest in both agricultural and pharmaceutical research. Its mechanism of action is primarily associated with the disruption of ion transport across cell membranes, leading to cell death in susceptible organisms. Additionally, enniatin B1 has been studied for its potential use as a biopesticide due to its efficacy against various plant pathogens. However, its toxicity and environmental impact are also considerations that require careful evaluation. Overall, enniatin B1 represents a significant compound in the study of natural products and their applications in combating microbial resistance and enhancing crop protection.
Formula:C34H59N3O9
InChI:InChI=1/C34H59N3O9/c1-16-22(12)25-34(43)46-27(20(8)9)30(39)36(14)23(17(2)3)32(41)44-26(19(6)7)29(38)35(13)24(18(4)5)33(42)45-28(21(10)11)31(40)37(25)15/h17-28H,16H2,1-15H3
SMILES:CCC(C)C1C(=O)OC(C(C)C)C(=O)N(C)C(C(C)C)C(=O)OC(C(C)C)C(=O)N(C)C(C(C)C)C(=O)OC(C(C)C)C(=O)N1C
Synonyms:- 3-(Butan-2-Yl)-4,10,16-Trimethyl-6,9,12,15,18-Penta(Propan-2-Yl)-1,7,13-Trioxa-4,10,16-Triazacyclooctadecane-2,5,8,11,14,17-Hexone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Cyclo[(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl]
CAS:Formula:C34H59N3O9Purity:98%Color and Shape:SolidMolecular weight:653.8470Enniatin B1
CAS:Enniatin B1, a Fusarium mycotoxin, crosses the blood-brain barrier and modulates ERK, NF-κB, and ACAT with an IC50 of 73 μM.Formula:C34H59N3O9Purity:98%Color and Shape:SolidMolecular weight:653.858Enniatin B1
CAS:Enniatin B1 is a cyclic depsipeptide, which is a type of mycotoxin produced by certain species of Fusarium fungi. It is characterized by its unique structural composition that includes alternating N-methylamino and hydroxy acid residues, forming a cyclic hexadepsipeptide. The source of Enniatin B1 primarily encompasses various Fusarium species, known for their ubiquitous presence in agricultural environments and propensity to contaminate cereal crops.
Purity:Min. 95%








