CymitQuimica logo

CAS 19914-38-6

:

BOC-N-methyl-D-alanine

Description:
BOC-N-methyl-D-alanine, with the CAS number 19914-38-6, is a chemical compound that serves as a protected form of the amino acid N-methyl-D-alanine. It features a tert-butyloxycarbonyl (BOC) group, which is commonly used in organic synthesis to protect amine functionalities during chemical reactions. This compound is typically utilized in peptide synthesis and other applications in medicinal chemistry due to its ability to enhance the stability and solubility of the amino acid during various synthetic processes. BOC-N-methyl-D-alanine is characterized by its relatively low toxicity and is soluble in organic solvents, making it suitable for laboratory use. Its structural features include a methyl group attached to the nitrogen atom of the amino acid, which influences its steric and electronic properties. As a derivative of D-alanine, it retains the chiral nature of the amino acid, which is significant in biological systems and pharmaceutical applications. Overall, BOC-N-methyl-D-alanine is an important intermediate in the synthesis of biologically active compounds.
Formula:C9H17NO4
InChI:InChI=1/C9H17NO4/c1-6(7(11)12)10(5)8(13)14-9(2,3)4/h6H,1-5H3,(H,11,12)/t6-/m1/s1
InChI key:VLHQXRIIQSTJCQ-ZCFIWIBFSA-N
SMILES:C[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C
Synonyms:
  • BOC-N-Me-D-Ala-OH
  • N-(tert-Butoxycarbonyl)-N-methyl-D-alanine
  • Boc-D-N-Me-Ala-OH
Found 6 products.