CymitQuimica logo

CAS 19948-85-7

:

N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzamide

Description:
N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzamide, with the CAS number 19948-85-7, is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the 4-methylphenyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. Thiadiazoles are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's amide linkage can also play a crucial role in its reactivity and stability, making it a subject of interest in medicinal chemistry. Additionally, its molecular structure suggests potential applications in drug development, particularly in designing agents that target specific biological pathways. Overall, N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzamide represents a fascinating example of how structural features can dictate the chemical and biological behavior of a compound.
Formula:C16H13N3OS
InChI:InChI=1S/C16H13N3OS/c1-11-7-9-13(10-8-11)15-18-19-16(21-15)17-14(20)12-5-3-2-4-6-12/h2-10H,1H3,(H,17,19,20)
InChI key:SIHYHKOFZPWMHZ-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2=NN=C(S2)NC(=O)C3=CC=CC=C3
Synonyms:
  • N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzamide
  • WAY-311677
  • N-(5-(p-Tolyl)-1,3,4-thiadiazol-2-yl)benzamide
  • MCF-7,B16-F10,cancer,PTK2,FAK,WAY311677,Inhibitor,inhibit,WAY 311677,PTK2 protein tyrosine kinase 2,Focal adhesion kinase
Found 4 products.