CAS 19952-47-7: 2-Amino-4-chlorobenzothiazole
Description:2-Amino-4-chlorobenzothiazole is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features an amino group (-NH2) and a chlorine atom (-Cl) at specific positions on the benzothiazole framework, contributing to its reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the amino group allows for hydrogen bonding, enhancing its solubility in water compared to other benzothiazole derivatives. 2-Amino-4-chlorobenzothiazole is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity, including antimicrobial and antifungal properties. Additionally, it can serve as an intermediate in the synthesis of other chemical compounds. However, handling this substance requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures in laboratory and industrial settings.
Formula:C7H5ClN2S
InChI:InChI=1S/C7H5ClN2S/c8-4-2-1-3-5-6(4)10-7(9)11-5/h1-3H,(H2,9,10)
InChI key:InChIKey=OEQQFQXMCPMEIH-UHFFFAOYSA-N
SMILES:ClC1=CC=CC=2SC(=NC12)N
- Synonyms:
- (4-Chlorobenzothiazol-2-yl)amine
- 2-Amino-4-chloro-1,3-benzothiazole
- 2-Benzothiazolamine, 4-chloro-
- 4-Chloro-1,3-Benzothiazol-2-Amine
- 4-Chloro-1,3-Benzothiazol-2-Ylamine
- 4-Chloro-2-benzothiazolamine
- 4-Chlorobenzo[D]Thiazol-2-Amine
- Benzothiazole, 2-amino-4-chloro-
- 2-Amino-4-chlorobenzothiazole

2-Amino-4-chlorobenzothiazole
Ref: 3B-A1087
5g | 83.00 € | ||
25g | 370.00 € |

2-Benzothiazolamine, 4-chloro-
Ref: IN-DA002C5O
1g | 23.00 € | ||
5g | 27.00 € | ||
10g | 31.00 € | ||
25g | 53.00 € | ||
100g | 130.00 € | ||
500g | 573.00 € |

2-Amino-4-chlorobenzothiazole
Ref: 7W-GK3395
Undefined size | To inquire |

2-Amino-4-chlorobenzothiazole
Ref: 10-F013399
1g | 24.00 € | ||
10g | 27.00 € | ||
25g | 47.00 € | ||
100g | 117.00 € | ||
500g | 501.00 € |

2-Amino-4-chlorobenzothiazole
Ref: 54-OR350002
100g | 205.00 € | ||
500g | 771.00 € |

2-Amino-4-chlorobenzothiazole
Ref: 3D-FA03106
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |