CymitQuimica logo

CAS 1995848-08-2

:

methyl 2-(3-((tert-butoxycarbonyl)amino)bicyclo[1.1.1]pentan-1-yl)acetate

Description:
Methyl 2-(3-((tert-butoxycarbonyl)amino)bicyclo[1.1.1]pentan-1-yl)acetate is a chemical compound characterized by its complex bicyclic structure and the presence of a tert-butoxycarbonyl (Boc) protecting group. This compound features a methyl ester functional group, which contributes to its reactivity and solubility in organic solvents. The bicyclo[1.1.1]pentane moiety provides a unique three-dimensional framework that can influence the compound's steric and electronic properties. The presence of the amino group suggests potential for further chemical modifications, such as coupling reactions or deprotection strategies. This compound may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is handled. As with many organic compounds, safety precautions should be taken when handling this substance due to potential hazards associated with its chemical structure.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-11(2,3)18-10(16)14-13-6-12(7-13,8-13)5-9(15)17-4/h5-8H2,1-4H3,(H,14,16)
InChI key:GKQBWYZBSWSEMI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC12CC(C1)(C2)CC(=O)OC
Synonyms:
  • methyl 2-(3-((tert-butoxycarbonyl)amino)bicyclo[1.1.1]pentan-1-yl)acetate
  • Bicyclo[1.1.1]pentane-1-acetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester
Found 3 products.